![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| structure-synth-dbg_1.5.0-7build2_amd64.deb | 2024-04-01 15:58 | 9.8M | |
| structure-synth-dbg_1.5.0-7_amd64.deb | 2021-04-06 23:25 | 9.6M | |
| structure-synth-dbg_1.5.0-6build1_amd64.deb | 2020-03-23 09:29 | 7.9M | |
| structure-synth-dbg_1.5.0-2_amd64.deb | 2012-11-16 00:42 | 6.2M | |
| structure-synth-dbg_1.5.0-2_i386.deb | 2012-11-16 00:43 | 5.8M | |
| structure-synth-dbg_1.5.0-3_amd64.deb | 2016-05-20 01:41 | 4.2M | |
| structure-synth-dbg_1.5.0-3_i386.deb | 2016-05-20 01:42 | 4.1M | |
| structure-synth_1.5.0-2_amd64.deb | 2012-11-16 00:42 | 443K | |
| structure-synth_1.5.0-2_i386.deb | 2012-11-16 00:43 | 440K | |
| structure-synth_1.5.0-7.3_amd64.deb | 2024-12-15 00:51 | 412K | |
| structure-synth_1.5.0-7build2_amd64.deb | 2024-04-01 15:58 | 386K | |
| structure-synth_1.5.0-3_amd64.deb | 2016-05-20 01:41 | 382K | |
| structure-synth_1.5.0-6build1_amd64.deb | 2020-03-23 09:29 | 380K | |
| structure-synth_1.5.0-3_i386.deb | 2016-05-20 01:42 | 369K | |
| structure-synth_1.5.0-7_amd64.deb | 2021-04-06 23:25 | 359K | |