Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[   ]](/icons/unknown.gif) | atcc.mol | 2019-11-25 18:53 | 2.0K | |
| ![[TXT]](/icons/text.gif) | atcc.sh | 2019-11-25 18:53 | 34 | |
| ![[TXT]](/icons/text.gif) | atcc.tex | 2019-11-25 18:53 | 957 | |
| ![[TXT]](/icons/text.gif) | buildscripts.sh | 2019-11-25 18:53 | 649 | |
| ![[TXT]](/icons/text.gif) | caffeine-from-smiles-rotated.sh | 2019-11-25 18:53 | 57 | |
| ![[TXT]](/icons/text.gif) | caffeine-from-smiles.sh | 2019-11-25 18:53 | 47 | |
| ![[TXT]](/icons/text.gif) | caffeine-smi.tex | 2019-11-25 18:53 | 138 | |
| ![[TXT]](/icons/text.gif) | caffeine-smi2.tex | 2019-11-25 18:53 | 209 | |
| ![[   ]](/icons/unknown.gif) | caffeine.mol | 2019-11-25 18:53 | 1.3K | |
| ![[   ]](/icons/unknown.gif) | caffeine.smi | 2019-11-25 18:53 | 29 | |
| ![[TXT]](/icons/text.gif) | ce-submol1.tex | 2019-11-25 18:53 | 1.2K | |
| ![[TXT]](/icons/text.gif) | ce-submol2.tex | 2019-11-25 18:53 | 1.9K | |
| ![[TXT]](/icons/text.gif) | ce-submol3.tex | 2019-11-25 18:53 | 1.2K | |
| ![[   ]](/icons/unknown.gif) | crown-ether.mol | 2019-11-25 18:53 | 3.4K | |
| ![[TXT]](/icons/text.gif) | cubane-cross-n.sh | 2019-11-25 18:53 | 63 | |
| ![[TXT]](/icons/text.gif) | cubane-cross.sh | 2019-11-25 18:53 | 60 | |
| ![[TXT]](/icons/text.gif) | cubane-n.sh | 2019-11-25 18:53 | 46 | |
| ![[TXT]](/icons/text.gif) | cubane-n.tex | 2019-11-25 18:53 | 676 | |
| ![[   ]](/icons/unknown.gif) | cubane.mol | 2019-11-25 18:53 | 902 | |
| ![[   ]](/icons/unknown.gif) | cubane.sdf | 2019-11-25 18:53 | 2.9K | |
| ![[TXT]](/icons/text.gif) | cubane.sh | 2019-11-25 18:53 | 43 | |
| ![[TXT]](/icons/text.gif) | daptomycin-u.sh | 2019-11-25 18:53 | 52 | |
| ![[TXT]](/icons/text.gif) | daptomycin-u.tex | 2019-11-25 18:53 | 6.1K | |
| ![[   ]](/icons/unknown.gif) | daptomycin.mol | 2019-11-25 18:53 | 10K | |
| ![[TXT]](/icons/text.gif) | daptomycin.tex | 2019-11-25 18:53 | 5.0K | |
| ![[TXT]](/icons/text.gif) | daptomycin1.sh | 2019-11-25 18:53 | 47 | |
| ![[TXT]](/icons/text.gif) | dcf-submol1.tex | 2019-11-25 18:53 | 1.0K | |
| ![[TXT]](/icons/text.gif) | dcf-submol2.tex | 2019-11-25 18:53 | 1.5K | |
| ![[TXT]](/icons/text.gif) | dcf-submol3.tex | 2019-11-25 18:53 | 1.2K | |
| ![[   ]](/icons/unknown.gif) | dichlorofluorescein.mol | 2019-11-25 18:53 | 2.6K | |
| ![[TXT]](/icons/text.gif) | dichlorofluorescein1.sh | 2019-11-25 18:53 | 114 | |
| ![[TXT]](/icons/text.gif) | dichlorofluorescein2.sh | 2019-11-25 18:53 | 140 | |
| ![[TXT]](/icons/text.gif) | dichlorofluorescein3.sh | 2019-11-25 18:53 | 161 | |
| ![[TXT]](/icons/text.gif) | doxo-from-sdf.sh | 2019-11-25 18:53 | 45 | |
| ![[TXT]](/icons/text.gif) | doxo-hand-rotated.sh | 2019-11-25 18:53 | 73 | |
| ![[TXT]](/icons/text.gif) | doxo-numbered.sh | 2019-11-25 18:53 | 63 | |
| ![[TXT]](/icons/text.gif) | doxo-numbered.tex | 2019-11-25 18:53 | 2.7K | |
| ![[TXT]](/icons/text.gif) | doxo-ratcheted-rotated.sh | 2019-11-25 18:53 | 75 | |
| ![[TXT]](/icons/text.gif) | doxo-ratcheted.sh | 2019-11-25 18:53 | 70 | |
| ![[TXT]](/icons/text.gif) | doxo-raw.tex | 2019-11-25 18:53 | 4.0K | |
| ![[TXT]](/icons/text.gif) | doxo-recalculated-flopped.sh | 2019-11-25 18:53 | 74 | |
| ![[TXT]](/icons/text.gif) | doxo-recalculated-flopped.tex | 2019-11-25 18:53 | 1.6K | |
| ![[TXT]](/icons/text.gif) | doxo-recalculated-rotated.sh | 2019-11-25 18:53 | 79 | |
| ![[TXT]](/icons/text.gif) | doxo-recalculated-rotated.tex | 2019-11-25 18:53 | 1.6K | |
| ![[TXT]](/icons/text.gif) | doxo-recalculated.sh | 2019-11-25 18:53 | 67 | |
| ![[TXT]](/icons/text.gif) | doxo-recalculated.tex | 2019-11-25 18:53 | 1.6K | |
| ![[TXT]](/icons/text.gif) | doxo-strip-h.sh | 2019-11-25 18:53 | 60 | |
| ![[TXT]](/icons/text.gif) | doxo-stripped.tex | 2019-11-25 18:53 | 2.0K | |
| ![[   ]](/icons/unknown.gif) | doxorubicin.sdf | 2019-11-25 18:53 | 8.9K | |
| ![[TXT]](/icons/text.gif) | eschers-cubane.tex | 2019-11-25 18:53 | 1.2K | |
| ![[   ]](/icons/unknown.gif) | fmnh.mol | 2019-11-25 18:53 | 3.0K | |
| ![[DIR]](/icons/folder.gif) | hand-coded-tex/ | 2019-11-25 19:47 | - | |
| ![[TXT]](/icons/text.gif) | morphine-f.sh | 2019-11-25 18:53 | 48 | |
| ![[TXT]](/icons/text.gif) | morphine-f.tex | 2019-11-25 18:53 | 1.0K | |
| ![[TXT]](/icons/text.gif) | morphine-k.sh | 2019-11-25 18:53 | 55 | |
| ![[TXT]](/icons/text.gif) | morphine-k.tex | 2019-11-25 18:53 | 1.5K | |
| ![[TXT]](/icons/text.gif) | morphine-n.sh | 2019-11-25 18:53 | 48 | |
| ![[TXT]](/icons/text.gif) | morphine-n.tex | 2019-11-25 18:53 | 1.4K | |
| ![[   ]](/icons/unknown.gif) | morphine.mol | 2019-11-25 18:53 | 2.1K | |
| ![[TXT]](/icons/text.gif) | morphine.sh | 2019-11-25 18:53 | 43 | |
| ![[TXT]](/icons/text.gif) | morphine.tex | 2019-11-25 18:53 | 1.0K | |
| ![[   ]](/icons/unknown.gif) | mp.mol | 2019-11-25 18:53 | 1.7K | |
| ![[TXT]](/icons/text.gif) | mp.sh | 2019-11-25 18:53 | 50 | |
| ![[TXT]](/icons/text.gif) | mp.tex | 2019-11-25 18:53 | 1.0K | |
| ![[   ]](/icons/layout.gif) | mp06900.pdf | 2019-11-25 18:53 | 219K | |
| ![[TXT]](/icons/text.gif) | optionlist.tex | 2019-11-25 18:53 | 5.7K | |
| ![[TXT]](/icons/text.gif) | packmoles.sh | 2019-11-25 18:53 | 38 | |
| ![[TXT]](/icons/text.gif) | phenol-add-h.sh | 2019-11-25 18:53 | 76 | |
| ![[TXT]](/icons/text.gif) | phenol-as-submol.sh | 2019-11-25 18:53 | 71 | |
| ![[TXT]](/icons/text.gif) | phenol-as-submol.tex | 2019-11-25 18:53 | 196 | |
| ![[TXT]](/icons/text.gif) | phenol-from-smiles-w.sh | 2019-11-25 18:53 | 66 | |
| ![[TXT]](/icons/text.gif) | phenol-from-smiles-wz.sh | 2019-11-25 18:53 | 65 | |
| ![[TXT]](/icons/text.gif) | phenol-from-smiles.sh | 2019-11-25 18:53 | 55 | |
| ![[TXT]](/icons/text.gif) | phenol-smi-terse.tex | 2019-11-25 18:53 | 59 | |
| ![[TXT]](/icons/text.gif) | phenol-smi-wrapped.tex | 2019-11-25 18:53 | 183 | |
| ![[TXT]](/icons/text.gif) | phenol-smi.tex | 2019-11-25 18:53 | 171 | |
| ![[TXT]](/icons/text.gif) | phenol-with-hydrogens.tex | 2019-11-25 18:53 | 444 | |
| ![[TXT]](/icons/text.gif) | plp-arrows.sh | 2019-11-25 18:53 | 84 | |
| ![[   ]](/icons/unknown.gif) | plp.mol | 2019-11-25 18:53 | 2.0K | |
| ![[TXT]](/icons/text.gif) | plp.sh | 2019-11-25 18:53 | 106 | |
| ![[TXT]](/icons/text.gif) | plp.tex | 2019-11-25 18:53 | 1.1K | |
| ![[   ]](/icons/unknown.gif) | plp2.mol | 2019-11-25 18:53 | 2.0K | |
| ![[TXT]](/icons/text.gif) | plp2.tex | 2019-11-25 18:53 | 1.0K | |
| ![[TXT]](/icons/text.gif) | printoptions.sh | 2019-11-25 18:53 | 29 | |
| ![[TXT]](/icons/text.gif) | setbondstyle.tex | 2019-11-25 18:53 | 119 | |
| ![[   ]](/icons/unknown.gif) | twisted.mol | 2019-11-25 18:53 | 450 | |
| ![[TXT]](/icons/text.gif) | twisted.sh | 2019-11-25 18:53 | 158 | |