Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[   ]](/icons/compressed.gif) | Catalyst-Authentication-Store-Htpasswd-1.004.tar.gz | 2016-05-11 15:04 | 24K | |
| ![[   ]](/icons/compressed.gif) | Test-Instance-Apache-0.001.tar.gz | 2016-07-05 14:40 | 14K | |
| ![[   ]](/icons/compressed.gif) | App-Antigen-0.001.tar.gz | 2015-03-26 17:17 | 12K | |
| ![[   ]](/icons/compressed.gif) | Test-Instance-DNS-0.001.tar.gz | 2018-12-18 15:46 | 11K | |
| ![[   ]](/icons/compressed.gif) | MooX-Options-Actions-0.001.tar.gz | 2017-04-24 16:26 | 9.9K | |
| ![[   ]](/icons/unknown.gif) | CHECKSUMS | 2021-11-22 02:33 | 4.0K | |
| ![[   ]](/icons/unknown.gif) | Test-Instance-Apache-0.001.readme | 2016-07-05 14:39 | 3.9K | |
| ![[   ]](/icons/unknown.gif) | App-Antigen-0.001.readme | 2015-03-26 17:14 | 3.1K | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Authentication-Store-Htpasswd-1.004.readme | 2016-05-11 13:09 | 2.0K | |
| ![[   ]](/icons/unknown.gif) | Test-Instance-DNS-0.001.meta | 2018-12-18 15:45 | 1.9K | |
| ![[   ]](/icons/unknown.gif) | Test-Instance-Apache-0.001.meta | 2016-07-05 14:39 | 1.8K | |
| ![[   ]](/icons/unknown.gif) | MooX-Options-Actions-0.001.meta | 2017-04-24 16:25 | 1.6K | |
| ![[   ]](/icons/unknown.gif) | App-Antigen-0.001.meta | 2015-03-26 17:14 | 1.6K | |
| ![[   ]](/icons/unknown.gif) | MooX-Options-Actions-0.001.readme | 2017-04-24 16:25 | 1.4K | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Authentication-Store-Htpasswd-1.004.meta | 2016-05-11 14:51 | 861 | |
| ![[   ]](/icons/unknown.gif) | Test-Instance-DNS-0.001.readme | 2018-12-18 15:45 | 830 | |