Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[   ]](/icons/unknown.gif) | Catalyst-Plugin-Authentication-Credential-CHAP-0.02.meta | 2006-03-08 19:04 | 546 | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Plugin-Authentication-Credential-CHAP-0.02.readme | 2006-03-08 19:04 | 5.1K | |
| ![[   ]](/icons/compressed.gif) | Catalyst-Plugin-Authentication-Credential-CHAP-0.02.tar.gz | 2006-03-08 19:11 | 8.5K | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Plugin-Authentication-Credential-CHAP-0.03.meta | 2006-12-11 16:39 | 687 | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Plugin-Authentication-Credential-CHAP-0.03.readme | 2006-12-11 16:39 | 5.1K | |
| ![[   ]](/icons/compressed.gif) | Catalyst-Plugin-Authentication-Credential-CHAP-0.03.tar.gz | 2006-12-11 16:41 | 9.9K | |
| ![[   ]](/icons/unknown.gif) | CHECKSUMS | 2021-11-22 01:23 | 2.1K | |