Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[   ]](/icons/unknown.gif) | CHECKSUMS | 2021-11-21 23:53 | 2.7K | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Action-RenderView-ErrorHandler-0.100165.meta | 2011-10-29 21:46 | 1.1K | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Action-RenderView-ErrorHandler-0.100165.readme | 2011-10-29 21:25 | 381 | |
| ![[   ]](/icons/compressed.gif) | Catalyst-Action-RenderView-ErrorHandler-0.100165.tar.gz | 2011-10-29 21:47 | 17K | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Action-RenderView-ErrorHandler-Action-Email-0.04.meta | 2011-10-29 21:27 | 671 | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Action-RenderView-ErrorHandler-Action-Email-0.04.readme | 2011-10-29 21:19 | 1.2K | |
| ![[   ]](/icons/compressed.gif) | Catalyst-Action-RenderView-ErrorHandler-Action-Email-0.04.tar.gz | 2011-10-29 21:28 | 3.5K | |
| ![[   ]](/icons/unknown.gif) | Net-SMS-O2_DE-0.07.meta | 2011-07-24 15:18 | 716 | |
| ![[   ]](/icons/unknown.gif) | Net-SMS-O2_DE-0.07.readme | 2011-07-18 17:13 | 2.2K | |
| ![[   ]](/icons/compressed.gif) | Net-SMS-O2_DE-0.07.tar.gz | 2011-07-24 15:27 | 8.5K | |