Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[   ]](/icons/unknown.gif) | CHECKSUMS | 2021-11-21 19:55 | 4.3K | |
| ![[   ]](/icons/compressed.gif) | PDF-Boxer-0.004.tar.gz | 2012-02-22 00:39 | 56K | |
| ![[   ]](/icons/unknown.gif) | PDF-Boxer-0.004.readme | 2012-02-22 00:38 | 1.1K | |
| ![[   ]](/icons/unknown.gif) | PDF-Boxer-0.004.meta | 2012-02-22 00:38 | 668 | |
| ![[   ]](/icons/unknown.gif) | Catalyst-View-PDFBoxer-0.001.readme | 2011-11-10 14:14 | 1.1K | |
| ![[   ]](/icons/unknown.gif) | Catalyst-View-PDFBoxer-0.001.meta | 2011-11-10 14:14 | 716 | |
| ![[   ]](/icons/compressed.gif) | Catalyst-View-PDFBoxer-0.001.tar.gz | 2011-11-10 14:11 | 9.9K | |
| ![[   ]](/icons/unknown.gif) | PDF-Boxer-0.003.readme | 2011-11-10 07:15 | 1.1K | |
| ![[   ]](/icons/unknown.gif) | PDF-Boxer-0.003.meta | 2011-11-10 07:15 | 668 | |
| ![[   ]](/icons/compressed.gif) | PDF-Boxer-0.003.tar.gz | 2011-11-10 07:12 | 54K | |
| ![[   ]](/icons/unknown.gif) | PDF-Boxer-0.002.readme | 2011-11-09 14:47 | 1.1K | |
| ![[   ]](/icons/unknown.gif) | PDF-Boxer-0.002.meta | 2011-11-09 14:47 | 668 | |
| ![[   ]](/icons/compressed.gif) | PDF-Boxer-0.002.tar.gz | 2011-11-09 14:44 | 54K | |
| ![[   ]](/icons/unknown.gif) | PDF-Boxer-0.001.readme | 2011-11-05 05:20 | 308 | |
| ![[   ]](/icons/unknown.gif) | PDF-Boxer-0.001.meta | 2011-11-05 05:20 | 668 | |
| ![[   ]](/icons/compressed.gif) | PDF-Boxer-0.001.tar.gz | 2011-11-05 05:17 | 48K | |
| ![[   ]](/icons/compressed.gif) | PDF-Boxer-0.001-TRIAL.tar.gz | 2011-11-04 15:20 | 47K | |