![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| KA/ | 2021-11-22 01:38 | - | |
| KB/ | 2021-11-22 01:44 | - | |
| KC/ | 2021-11-22 01:44 | - | |
| KD/ | 2021-11-22 01:38 | - | |
| KE/ | 2023-05-24 01:19 | - | |
| KF/ | 2021-11-22 01:43 | - | |
| KG/ | 2021-11-22 01:36 | - | |
| KH/ | 2021-11-22 01:31 | - | |
| KI/ | 2021-11-22 01:32 | - | |
| KJ/ | 2021-11-22 01:43 | - | |
| KK/ | 2021-11-22 01:41 | - | |
| KL/ | 2025-07-24 16:18 | - | |
| KM/ | 2021-11-22 01:38 | - | |
| KN/ | 2021-11-30 08:22 | - | |
| KO/ | 2025-09-18 08:18 | - | |
| KP/ | 2021-11-22 01:41 | - | |
| KR/ | 2023-12-02 00:21 | - | |
| KS/ | 2021-11-22 01:43 | - | |
| KT/ | 2021-11-22 01:31 | - | |
| KU/ | 2021-11-22 01:42 | - | |
| KV/ | 2021-11-22 01:41 | - | |
| KW/ | 2021-11-22 01:36 | - | |
| KX/ | 2022-02-11 00:23 | - | |
| KY/ | 2021-11-22 01:35 | - | |
| KZ/ | 2021-11-22 01:41 | - | |
| CHECKSUMS | 2021-11-22 01:31 | 2.1K | |