Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[   ]](/icons/compressed.gif) | DBR-1.2.tar.gz | 2011-05-21 03:07 | 271K | |
| ![[   ]](/icons/compressed.gif) | DBR-1.5.tar.gz | 2011-06-17 00:38 | 257K | |
| ![[   ]](/icons/compressed.gif) | DBR-1.4.tar.gz | 2011-06-16 02:18 | 256K | |
| ![[   ]](/icons/compressed.gif) | DBR-1.0.7rc7.tar.gz | 2010-02-18 10:05 | 256K | |
| ![[   ]](/icons/compressed.gif) | DBR-1.0.7rc6.tar.gz | 2009-12-01 23:09 | 256K | |
| ![[   ]](/icons/compressed.gif) | DBR-1.0.7rc5.tar.gz | 2009-11-24 09:54 | 256K | |
| ![[   ]](/icons/compressed.gif) | DBR-1.0.7rc2.tar.gz | 2009-09-19 09:10 | 254K | |
| ![[   ]](/icons/compressed.gif) | DBR-1.3.tar.gz | 2011-05-24 00:45 | 252K | |
| ![[   ]](/icons/unknown.gif) | CHECKSUMS | 2021-11-21 21:07 | 6.3K | |
| ![[   ]](/icons/compressed.gif) | Catalyst-Model-DBR-1.0.tar.gz | 2011-06-17 03:10 | 2.7K | |
| ![[   ]](/icons/unknown.gif) | DBR-1.5.meta | 2011-06-17 00:36 | 1.1K | |
| ![[   ]](/icons/unknown.gif) | DBR-1.4.meta | 2011-06-16 02:15 | 1.1K | |
| ![[   ]](/icons/unknown.gif) | DBR-1.0.7rc7.meta | 2010-02-18 10:01 | 1.0K | |
| ![[   ]](/icons/unknown.gif) | DBR-1.0.7rc6.meta | 2009-12-01 23:07 | 1.0K | |
| ![[   ]](/icons/unknown.gif) | DBR-1.0.7rc5.meta | 2009-11-24 09:54 | 1.0K | |
| ![[   ]](/icons/unknown.gif) | DBR-1.3.meta | 2011-05-24 00:42 | 1.0K | |
| ![[   ]](/icons/unknown.gif) | DBR-1.2.meta | 2011-05-21 03:06 | 1.0K | |
| ![[   ]](/icons/unknown.gif) | DBR-1.5.readme | 2011-06-14 02:58 | 1.0K | |
| ![[   ]](/icons/unknown.gif) | DBR-1.4.readme | 2011-06-14 02:58 | 1.0K | |
| ![[   ]](/icons/unknown.gif) | DBR-1.0.7rc2.meta | 2009-09-19 09:09 | 1.0K | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Model-DBR-1.0.meta | 2011-06-17 03:07 | 519 | |
| ![[   ]](/icons/unknown.gif) | DBR-1.3.readme | 2011-05-24 00:22 | 399 | |
| ![[   ]](/icons/unknown.gif) | DBR-1.2.readme | 2011-05-21 02:45 | 399 | |
| ![[   ]](/icons/unknown.gif) | DBR-1.0.7rc7.readme | 2010-02-18 10:01 | 316 | |
| ![[   ]](/icons/unknown.gif) | DBR-1.0.7rc6.readme | 2009-12-01 23:07 | 316 | |
| ![[   ]](/icons/unknown.gif) | DBR-1.0.7rc5.readme | 2009-11-24 09:53 | 316 | |
| ![[   ]](/icons/unknown.gif) | DBR-1.0.7rc2.readme | 2009-09-19 09:01 | 316 | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Model-DBR-1.0.readme | 2011-06-17 02:59 | 64 | |