Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[   ]](/icons/compressed.gif) | Rose-DBx-Object-Metadata-Column-Xml-0.782.tar.gz | 2011-10-17 10:59 | 4.1K | |
| ![[   ]](/icons/unknown.gif) | Rose-DBx-Object-Metadata-Column-Xml-0.782.readme | 2011-08-23 06:59 | 1.7K | |
| ![[   ]](/icons/compressed.gif) | Rose-DBx-Object-Metadata-Column-Xml-0.781.tar.gz | 2011-08-23 12:24 | 4.1K | |
| ![[   ]](/icons/unknown.gif) | Rose-DBx-Object-Metadata-Column-Xml-0.781.readme | 2011-08-23 06:59 | 1.7K | |
| ![[   ]](/icons/compressed.gif) | Catalyst-Authentication-Store-LDAP-AD-Class-0.06.tar.gz | 2011-02-21 12:02 | 6.5K | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Authentication-Store-LDAP-AD-Class-0.06.readme | 2010-02-24 09:15 | 1.7K | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Authentication-Store-LDAP-AD-Class-0.06.meta | 2010-09-16 12:09 | 757 | |
| ![[   ]](/icons/unknown.gif) | CHECKSUMS | 2021-11-22 02:16 | 2.2K | |