Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[   ]](/icons/unknown.gif) | Catalyst-Plugin-Authentication-Credential-GooglePlus-0.1.readme | 2015-03-25 11:16 | 1.4K | |
| ![[   ]](/icons/unknown.gif) | Catalyst-Plugin-Authentication-Credential-GooglePlus-0.1.meta | 2015-03-25 11:17 | 738 | |
| ![[   ]](/icons/compressed.gif) | Catalyst-Plugin-Authentication-Credential-GooglePlus-0.1.tar.gz | 2015-03-25 11:19 | 24K | |
| ![[   ]](/icons/unknown.gif) | Map-Tube-Athens-0.01.meta | 2017-11-27 00:20 | 1.8K | |
| ![[   ]](/icons/unknown.gif) | Map-Tube-Athens-0.01.readme | 2017-11-27 00:20 | 1.4K | |
| ![[   ]](/icons/compressed.gif) | Map-Tube-Athens-0.01.tar.gz | 2017-11-27 00:21 | 17K | |
| ![[   ]](/icons/unknown.gif) | CHECKSUMS | 2021-11-22 00:12 | 2.0K | |