Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[   ]](/icons/compressed.gif) | Wx-Data-0.01_01.tar.gz | 2007-07-08 10:49 | 20K | |
| ![[   ]](/icons/compressed.gif) | POE-Component-Server-MySQL-0.02.tar.gz | 2010-10-20 17:03 | 11K | |
| ![[   ]](/icons/unknown.gif) | POE-Component-Server-MySQL-0.02.readme | 2010-10-20 10:52 | 1.5K | |
| ![[   ]](/icons/unknown.gif) | POE-Component-Server-MySQL-0.02.meta | 2010-10-20 17:02 | 758 | |
| ![[   ]](/icons/compressed.gif) | POE-Component-Server-MySQL-0.01_01.tar.gz | 2010-09-27 11:51 | 11K | |
| ![[   ]](/icons/compressed.gif) | POE-Component-Server-MySQL-0.01.tar.gz | 2010-10-20 11:07 | 11K | |
| ![[   ]](/icons/unknown.gif) | POE-Component-Server-MySQL-0.01.readme | 2010-10-20 10:52 | 1.5K | |
| ![[   ]](/icons/unknown.gif) | POE-Component-Server-MySQL-0.01.meta | 2010-10-20 11:04 | 758 | |
| ![[   ]](/icons/compressed.gif) | POE-Component-Proxy-MySQL-0.04.tar.gz | 2013-10-17 10:02 | 8.3K | |
| ![[   ]](/icons/unknown.gif) | POE-Component-Proxy-MySQL-0.04.readme | 2013-03-29 20:58 | 145 | |
| ![[   ]](/icons/unknown.gif) | POE-Component-Proxy-MySQL-0.04.meta | 2013-10-17 09:50 | 1.1K | |
| ![[   ]](/icons/compressed.gif) | Data-Generator-0.01_1.tar.gz | 2010-12-14 09:21 | 3.4K | |
| ![[   ]](/icons/compressed.gif) | Catalyst-View-R-0.01_2.tar.gz | 2012-02-25 19:58 | 45K | |
| ![[   ]](/icons/compressed.gif) | Catalyst-Engine-Wx-0.02_06.tar.gz | 2008-05-01 19:22 | 30K | |
| ![[   ]](/icons/unknown.gif) | CHECKSUMS | 2021-11-23 09:07 | 5.3K | |
| ![[   ]](/icons/compressed.gif) | API-Mathpix-0.01.tar.gz | 2021-11-22 09:07 | 6.2K | |
| ![[   ]](/icons/unknown.gif) | API-Mathpix-0.01.readme | 2021-11-22 10:04 | 853 | |
| ![[   ]](/icons/unknown.gif) | API-Mathpix-0.01.meta | 2021-11-22 10:04 | 1.7K | |