![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| CHECKSUMS | 2021-11-22 01:56 | 2.1K | |
| Catalyst-Authentication-Credential-FBConnect-0.01.meta | 2009-07-24 16:04 | 762 | |
| Catalyst-Authentication-Credential-FBConnect-0.01.readme | 2009-07-23 00:48 | 0 | |
| Catalyst-Authentication-Credential-FBConnect-0.01.tar.gz | 2009-07-24 16:04 | 15K | |
| Catalyst-Authentication-Credential-OAuth-0.01.meta | 2009-07-24 16:08 | 715 | |
| Catalyst-Authentication-Credential-OAuth-0.01.readme | 2009-07-23 00:48 | 0 | |
| Catalyst-Authentication-Credential-OAuth-0.01.tar.gz | 2009-07-24 16:08 | 16K | |