Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[   ]](/icons/unknown.gif) | CHECKSUMS | 2021-11-22 00:28 | 6.0K | |
| ![[   ]](/icons/compressed.gif) | Amphibic-Log-0.02-TRIAL.tar.gz | 2010-10-20 09:29 | 10K | |
| ![[   ]](/icons/compressed.gif) | Amphibic-Log-0.01-TRIAL.tar.gz | 2010-10-20 02:51 | 15K | |
| ![[   ]](/icons/compressed.gif) | KiokuDB-Backend-CHI-0.01-TRIAL.tar.gz | 2010-05-20 12:46 | 9.0K | |
| ![[   ]](/icons/compressed.gif) | DBIx-Class-Tree-CalculateSets-0.04.tar.gz | 2009-10-28 12:55 | 16K | |
| ![[   ]](/icons/unknown.gif) | DBIx-Class-Tree-CalculateSets-0.04.meta | 2009-10-28 12:54 | 541 | |
| ![[   ]](/icons/compressed.gif) | Config-Settings-0.02.tar.gz | 2009-08-01 12:58 | 18K | |
| ![[   ]](/icons/compressed.gif) | Catalyst-Controller-MetaForm-0.01_03.tar.gz | 2009-06-08 14:06 | 16K | |
| ![[   ]](/icons/compressed.gif) | Class-MetaForm-0.01_02.tar.gz | 2009-06-08 14:06 | 17K | |
| ![[   ]](/icons/compressed.gif) | SOAP-Simple-0.00_03.tar.gz | 2009-03-30 10:33 | 15K | |
| ![[   ]](/icons/unknown.gif) | Config-Settings-0.02.meta | 2008-11-18 05:54 | 471 | |
| ![[   ]](/icons/compressed.gif) | Filter-PPI-0.00_01.tar.gz | 2008-04-12 02:50 | 18K | |
| ![[   ]](/icons/compressed.gif) | Test-XML-RPC-Catalyst-0.01.tar.gz | 2008-03-20 20:36 | 18K | |
| ![[   ]](/icons/unknown.gif) | Test-XML-RPC-Catalyst-0.01.meta | 2008-03-20 20:32 | 531 | |
| ![[   ]](/icons/compressed.gif) | Proc-Simple-Async-0.03.tar.gz | 2007-11-25 08:17 | 18K | |
| ![[   ]](/icons/unknown.gif) | Proc-Simple-Async-0.03.meta | 2007-11-25 08:15 | 407 | |